About 3-[[4-(2-fluorophenyl)piperazin-1-yl]methyl]-5-(2-methoxyphenyl)-1,3,4-oxadiazole-2-thione
3-[[4-(2-fluorophenyl)piperazin-1-yl]methyl]-5-(2-methoxyphenyl)-1,3,4-oxadiazole-2-thione (PubChem CID 26936742) has the molecular formula C20H21FN4O2S
and a molecular weight of 400.48 g/mol. Its IUPAC name is 3-[[4-(2-fluorophenyl)piperazin-1-yl]methyl]-5-(2-methoxyphenyl)-1,3,4-oxadiazole-2-thione.
Molecular Properties
| Compound Name | 3-[[4-(2-fluorophenyl)piperazin-1-yl]methyl]-5-(2-methoxyphenyl)-1,3,4-oxadiazole-2-thione |
| PubChem CID | 26936742 |
| Molecular Formula | C20H21FN4O2S |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | 3-[[4-(2-fluorophenyl)piperazin-1-yl]methyl]-5-(2-methoxyphenyl)-1,3,4-oxadiazole-2-thione |
| SMILES | COc1ccccc1-c1nn(CN2CCN(c3ccccc3F)CC2)c(=S)o1 |
| InChI | InChI=1S/C20H21FN4O2S/c1-26-18-9-5-2-6-15(18)19-22-25(20(28)27-19)14-23-10-12-24(13-11-23)17-8-4-3-7-16(17)21/h2-9H,10-14H2,1H3 |
| InChIKey | LCJPBQFGFQZCPU-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 46.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-[[4-(2-fluorophenyl)piperazin-1-yl]methyl]-5-(2-methoxyphenyl)-1,3,4-oxadiazole-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[4-(2-fluorophenyl)piperazin-1-yl]methyl]-5-(2-methoxyphenyl)-1,3,4-oxadiazole-2-thione?
The IUPAC name of 3-[[4-(2-fluorophenyl)piperazin-1-yl]methyl]-5-(2-methoxyphenyl)-1,3,4-oxadiazole-2-thione (CID 26936742) is 3-[[4-(2-fluorophenyl)piperazin-1-yl]methyl]-5-(2-methoxyphenyl)-1,3,4-oxadiazole-2-thione.
What is the SMILES notation for 3-[[4-(2-fluorophenyl)piperazin-1-yl]methyl]-5-(2-methoxyphenyl)-1,3,4-oxadiazole-2-thione?
The canonical SMILES for 3-[[4-(2-fluorophenyl)piperazin-1-yl]methyl]-5-(2-methoxyphenyl)-1,3,4-oxadiazole-2-thione is COc1ccccc1-c1nn(CN2CCN(c3ccccc3F)CC2)c(=S)o1.
What is the InChIKey of 3-[[4-(2-fluorophenyl)piperazin-1-yl]methyl]-5-(2-methoxyphenyl)-1,3,4-oxadiazole-2-thione?
The InChIKey is LCJPBQFGFQZCPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21FN4O2S/c1-26-18-9-5-2-6-15(18)19-22-25(20(28)27-19)14-23-10-12-24(13-11-23)17-8-4-3-7-16(17)21/h2-9H,10-14H2,1H3.
What are the key properties of 3-[[4-(2-fluorophenyl)piperazin-1-yl]methyl]-5-(2-methoxyphenyl)-1,3,4-oxadiazole-2-thione?
3-[[4-(2-fluorophenyl)piperazin-1-yl]methyl]-5-(2-methoxyphenyl)-1,3,4-oxadiazole-2-thione has a molecular weight of 400.48 g/mol, XLogP of 3.80, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[4-(2-fluorophenyl)piperazin-1-yl]methyl]-5-(2-methoxyphenyl)-1,3,4-oxadiazole-2-thione is sourced from PubChem (CID 26936742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).