C17H20N2O3S — CID 26941914
2-[benzenesulfonyl(methyl)amino]-N-(2,6-dimethylphenyl)acetamide (PubChem CID 26941914) has the molecular formula C17H20N2O3S and a molecular weight of 332.43 g/mol. Its IUPAC name is 2-[benzenesulfonyl(methyl)amino]-N-(2,6-dimethylphenyl)acetamide.
| Compound Name | 2-[benzenesulfonyl(methyl)amino]-N-(2,6-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 26941914 |
| Molecular Formula | C17H20N2O3S |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | 2-[benzenesulfonyl(methyl)amino]-N-(2,6-dimethylphenyl)acetamide |
| SMILES | Cc1cccc(C)c1NC(=O)CN(C)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C17H20N2O3S/c1-13-8-7-9-14(2)17(13)18-16(20)12-19(3)23(21,22)15-10-5-4-6-11-15/h4-11H,12H2,1-3H3,(H,18,20) |
| InChIKey | FSNNDJUYZANPCT-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |