About (3,4-difluorophenyl) 2-bromobenzenesulfonate
(3,4-difluorophenyl) 2-bromobenzenesulfonate (PubChem CID 26943973) has the molecular formula C12H7BrF2O3S
and a molecular weight of 349.15 g/mol. Its IUPAC name is (3,4-difluorophenyl) 2-bromobenzenesulfonate.
Molecular Properties
| Compound Name | (3,4-difluorophenyl) 2-bromobenzenesulfonate |
| PubChem CID | 26943973 |
| Molecular Formula | C12H7BrF2O3S |
| Molecular Weight | 349.15 g/mol |
| Exact Mass | 347.93 |
| IUPAC Name | (3,4-difluorophenyl) 2-bromobenzenesulfonate |
| SMILES | O=S(=O)(Oc1ccc(F)c(F)c1)c1ccccc1Br |
| InChI | InChI=1S/C12H7BrF2O3S/c13-9-3-1-2-4-12(9)19(16,17)18-8-5-6-10(14)11(15)7-8/h1-7H |
| InChIKey | SHTVZPMBERAMRL-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.15 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (3,4-difluorophenyl) 2-bromobenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,4-difluorophenyl) 2-bromobenzenesulfonate?
The IUPAC name of (3,4-difluorophenyl) 2-bromobenzenesulfonate (CID 26943973) is (3,4-difluorophenyl) 2-bromobenzenesulfonate.
What is the SMILES notation for (3,4-difluorophenyl) 2-bromobenzenesulfonate?
The canonical SMILES for (3,4-difluorophenyl) 2-bromobenzenesulfonate is O=S(=O)(Oc1ccc(F)c(F)c1)c1ccccc1Br.
What is the InChIKey of (3,4-difluorophenyl) 2-bromobenzenesulfonate?
The InChIKey is SHTVZPMBERAMRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7BrF2O3S/c13-9-3-1-2-4-12(9)19(16,17)18-8-5-6-10(14)11(15)7-8/h1-7H.
What are the key properties of (3,4-difluorophenyl) 2-bromobenzenesulfonate?
(3,4-difluorophenyl) 2-bromobenzenesulfonate has a molecular weight of 349.15 g/mol, XLogP of 3.49, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3,4-difluorophenyl) 2-bromobenzenesulfonate is sourced from PubChem (CID 26943973), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).