About (2-methylphenyl) 3,5-dimethyl-1,2-oxazole-4-sulfonate
(2-methylphenyl) 3,5-dimethyl-1,2-oxazole-4-sulfonate (PubChem CID 26946427) has the molecular formula C12H13NO4S
and a molecular weight of 267.31 g/mol. Its IUPAC name is (2-methylphenyl) 3,5-dimethyl-1,2-oxazole-4-sulfonate.
Molecular Properties
| Compound Name | (2-methylphenyl) 3,5-dimethyl-1,2-oxazole-4-sulfonate |
| PubChem CID | 26946427 |
| Molecular Formula | C12H13NO4S |
| Molecular Weight | 267.31 g/mol |
| Exact Mass | 267.06 |
| IUPAC Name | (2-methylphenyl) 3,5-dimethyl-1,2-oxazole-4-sulfonate |
| SMILES | Cc1ccccc1OS(=O)(=O)c1c(C)noc1C |
| InChI | InChI=1S/C12H13NO4S/c1-8-6-4-5-7-11(8)17-18(14,15)12-9(2)13-16-10(12)3/h4-7H,1-3H3 |
| InChIKey | QCHNVUXEZVCGDF-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 69.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.31 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (2-methylphenyl) 3,5-dimethyl-1,2-oxazole-4-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methylphenyl) 3,5-dimethyl-1,2-oxazole-4-sulfonate?
The IUPAC name of (2-methylphenyl) 3,5-dimethyl-1,2-oxazole-4-sulfonate (CID 26946427) is (2-methylphenyl) 3,5-dimethyl-1,2-oxazole-4-sulfonate.
What is the SMILES notation for (2-methylphenyl) 3,5-dimethyl-1,2-oxazole-4-sulfonate?
The canonical SMILES for (2-methylphenyl) 3,5-dimethyl-1,2-oxazole-4-sulfonate is Cc1ccccc1OS(=O)(=O)c1c(C)noc1C.
What is the InChIKey of (2-methylphenyl) 3,5-dimethyl-1,2-oxazole-4-sulfonate?
The InChIKey is QCHNVUXEZVCGDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NO4S/c1-8-6-4-5-7-11(8)17-18(14,15)12-9(2)13-16-10(12)3/h4-7H,1-3H3.
What are the key properties of (2-methylphenyl) 3,5-dimethyl-1,2-oxazole-4-sulfonate?
(2-methylphenyl) 3,5-dimethyl-1,2-oxazole-4-sulfonate has a molecular weight of 267.31 g/mol, XLogP of 2.37, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methylphenyl) 3,5-dimethyl-1,2-oxazole-4-sulfonate is sourced from PubChem (CID 26946427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).