About (2-chloro-4-fluorophenyl) 4-bromobenzenesulfonate
(2-chloro-4-fluorophenyl) 4-bromobenzenesulfonate (PubChem CID 26947930) has the molecular formula C12H7BrClFO3S
and a molecular weight of 365.61 g/mol. Its IUPAC name is (2-chloro-4-fluorophenyl) 4-bromobenzenesulfonate.
Molecular Properties
| Compound Name | (2-chloro-4-fluorophenyl) 4-bromobenzenesulfonate |
| PubChem CID | 26947930 |
| Molecular Formula | C12H7BrClFO3S |
| Molecular Weight | 365.61 g/mol |
| Exact Mass | 363.90 |
| IUPAC Name | (2-chloro-4-fluorophenyl) 4-bromobenzenesulfonate |
| SMILES | O=S(=O)(Oc1ccc(F)cc1Cl)c1ccc(Br)cc1 |
| InChI | InChI=1S/C12H7BrClFO3S/c13-8-1-4-10(5-2-8)19(16,17)18-12-6-3-9(15)7-11(12)14/h1-7H |
| InChIKey | SNWSTOXPIMAJRS-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.61 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (2-chloro-4-fluorophenyl) 4-bromobenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-chloro-4-fluorophenyl) 4-bromobenzenesulfonate?
The IUPAC name of (2-chloro-4-fluorophenyl) 4-bromobenzenesulfonate (CID 26947930) is (2-chloro-4-fluorophenyl) 4-bromobenzenesulfonate.
What is the SMILES notation for (2-chloro-4-fluorophenyl) 4-bromobenzenesulfonate?
The canonical SMILES for (2-chloro-4-fluorophenyl) 4-bromobenzenesulfonate is O=S(=O)(Oc1ccc(F)cc1Cl)c1ccc(Br)cc1.
What is the InChIKey of (2-chloro-4-fluorophenyl) 4-bromobenzenesulfonate?
The InChIKey is SNWSTOXPIMAJRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7BrClFO3S/c13-8-1-4-10(5-2-8)19(16,17)18-12-6-3-9(15)7-11(12)14/h1-7H.
What are the key properties of (2-chloro-4-fluorophenyl) 4-bromobenzenesulfonate?
(2-chloro-4-fluorophenyl) 4-bromobenzenesulfonate has a molecular weight of 365.61 g/mol, XLogP of 4.01, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-chloro-4-fluorophenyl) 4-bromobenzenesulfonate is sourced from PubChem (CID 26947930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).