About (2,2-dimethyl-3H-1-benzofuran-7-yl) 2-nitrobenzenesulfonate
(2,2-dimethyl-3H-1-benzofuran-7-yl) 2-nitrobenzenesulfonate (PubChem CID 26948958) has the molecular formula C16H15NO6S
and a molecular weight of 349.36 g/mol. Its IUPAC name is (2,2-dimethyl-3H-1-benzofuran-7-yl) 2-nitrobenzenesulfonate.
Molecular Properties
| Compound Name | (2,2-dimethyl-3H-1-benzofuran-7-yl) 2-nitrobenzenesulfonate |
| PubChem CID | 26948958 |
| Molecular Formula | C16H15NO6S |
| Molecular Weight | 349.36 g/mol |
| Exact Mass | 349.06 |
| IUPAC Name | (2,2-dimethyl-3H-1-benzofuran-7-yl) 2-nitrobenzenesulfonate |
| SMILES | CC1(C)Cc2cccc(OS(=O)(=O)c3ccccc3[N+](=O)[O-])c2O1 |
| InChI | InChI=1S/C16H15NO6S/c1-16(2)10-11-6-5-8-13(15(11)22-16)23-24(20,21)14-9-4-3-7-12(14)17(18)19/h3-9H,10H2,1-2H3 |
| InChIKey | SCJCGUGGXDCBTK-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 95.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.36 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (2,2-dimethyl-3H-1-benzofuran-7-yl) 2-nitrobenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,2-dimethyl-3H-1-benzofuran-7-yl) 2-nitrobenzenesulfonate?
The IUPAC name of (2,2-dimethyl-3H-1-benzofuran-7-yl) 2-nitrobenzenesulfonate (CID 26948958) is (2,2-dimethyl-3H-1-benzofuran-7-yl) 2-nitrobenzenesulfonate.
What is the SMILES notation for (2,2-dimethyl-3H-1-benzofuran-7-yl) 2-nitrobenzenesulfonate?
The canonical SMILES for (2,2-dimethyl-3H-1-benzofuran-7-yl) 2-nitrobenzenesulfonate is CC1(C)Cc2cccc(OS(=O)(=O)c3ccccc3[N+](=O)[O-])c2O1.
What is the InChIKey of (2,2-dimethyl-3H-1-benzofuran-7-yl) 2-nitrobenzenesulfonate?
The InChIKey is SCJCGUGGXDCBTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15NO6S/c1-16(2)10-11-6-5-8-13(15(11)22-16)23-24(20,21)14-9-4-3-7-12(14)17(18)19/h3-9H,10H2,1-2H3.
What are the key properties of (2,2-dimethyl-3H-1-benzofuran-7-yl) 2-nitrobenzenesulfonate?
(2,2-dimethyl-3H-1-benzofuran-7-yl) 2-nitrobenzenesulfonate has a molecular weight of 349.36 g/mol, XLogP of 3.08, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2,2-dimethyl-3H-1-benzofuran-7-yl) 2-nitrobenzenesulfonate is sourced from PubChem (CID 26948958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).