C18H22FNO4S — CID 26949915
N-(3,4-dipropoxyphenyl)-3-fluorobenzenesulfonamide (PubChem CID 26949915) has the molecular formula C18H22FNO4S and a molecular weight of 367.44 g/mol. Its IUPAC name is N-(3,4-dipropoxyphenyl)-3-fluorobenzenesulfonamide.
| Compound Name | N-(3,4-dipropoxyphenyl)-3-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 26949915 |
| Molecular Formula | C18H22FNO4S |
| Molecular Weight | 367.44 g/mol |
| Exact Mass | 367.13 |
| IUPAC Name | N-(3,4-dipropoxyphenyl)-3-fluorobenzenesulfonamide |
| SMILES | CCCOc1ccc(NS(=O)(=O)c2cccc(F)c2)cc1OCCC |
| InChI | InChI=1S/C18H22FNO4S/c1-3-10-23-17-9-8-15(13-18(17)24-11-4-2)20-25(21,22)16-7-5-6-14(19)12-16/h5-9,12-13,20H,3-4,10-11H2,1-2H3 |
| InChIKey | BYOPXWXQEDGWIS-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.44 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |