C15H15F3N4O4S2 — CID 26950922
4-methyl-2-morpholin-4-yl-N'-(2,3,4-trifluorophenyl)sulfonyl-1,3-thiazole-5-carbohydrazide (PubChem CID 26950922) has the molecular formula C15H15F3N4O4S2 and a molecular weight of 436.44 g/mol. Its IUPAC name is 4-methyl-2-morpholin-4-yl-N'-(2,3,4-trifluorophenyl)sulfonyl-1,3-thiazole-5-carbohydrazide.
| Compound Name | 4-methyl-2-morpholin-4-yl-N'-(2,3,4-trifluorophenyl)sulfonyl-1,3-thiazole-5-carbohydrazide |
|---|---|
| PubChem CID | 26950922 |
| Molecular Formula | C15H15F3N4O4S2 |
| Molecular Weight | 436.44 g/mol |
| Exact Mass | 436.05 |
| IUPAC Name | 4-methyl-2-morpholin-4-yl-N'-(2,3,4-trifluorophenyl)sulfonyl-1,3-thiazole-5-carbohydrazide |
| SMILES | Cc1nc(N2CCOCC2)sc1C(=O)NNS(=O)(=O)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C15H15F3N4O4S2/c1-8-13(27-15(19-8)22-4-6-26-7-5-22)14(23)20-21-28(24,25)10-3-2-9(16)11(17)12(10)18/h2-3,21H,4-7H2,1H3,(H,20,23) |
| InChIKey | RHTCSKMJXVQPHY-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.44 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|