About N-(4-methoxyphenyl)-2,4-dinitrobenzenesulfonamide
N-(4-methoxyphenyl)-2,4-dinitrobenzenesulfonamide (PubChem CID 26952364) has the molecular formula C13H11N3O7S
and a molecular weight of 353.31 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-2,4-dinitrobenzenesulfonamide.
Molecular Properties
| Compound Name | N-(4-methoxyphenyl)-2,4-dinitrobenzenesulfonamide |
| PubChem CID | 26952364 |
| Molecular Formula | C13H11N3O7S |
| Molecular Weight | 353.31 g/mol |
| Exact Mass | 353.03 |
| IUPAC Name | N-(4-methoxyphenyl)-2,4-dinitrobenzenesulfonamide |
| SMILES | COc1ccc(NS(=O)(=O)c2ccc([N+](=O)[O-])cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C13H11N3O7S/c1-23-11-5-2-9(3-6-11)14-24(21,22)13-7-4-10(15(17)18)8-12(13)16(19)20/h2-8,14H,1H3 |
| InChIKey | HGTSEBGNDLMIKK-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 141.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.31 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(4-methoxyphenyl)-2,4-dinitrobenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-methoxyphenyl)-2,4-dinitrobenzenesulfonamide?
The IUPAC name of N-(4-methoxyphenyl)-2,4-dinitrobenzenesulfonamide (CID 26952364) is N-(4-methoxyphenyl)-2,4-dinitrobenzenesulfonamide.
What is the SMILES notation for N-(4-methoxyphenyl)-2,4-dinitrobenzenesulfonamide?
The canonical SMILES for N-(4-methoxyphenyl)-2,4-dinitrobenzenesulfonamide is COc1ccc(NS(=O)(=O)c2ccc([N+](=O)[O-])cc2[N+](=O)[O-])cc1.
What is the InChIKey of N-(4-methoxyphenyl)-2,4-dinitrobenzenesulfonamide?
The InChIKey is HGTSEBGNDLMIKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11N3O7S/c1-23-11-5-2-9(3-6-11)14-24(21,22)13-7-4-10(15(17)18)8-12(13)16(19)20/h2-8,14H,1H3.
What are the key properties of N-(4-methoxyphenyl)-2,4-dinitrobenzenesulfonamide?
N-(4-methoxyphenyl)-2,4-dinitrobenzenesulfonamide has a molecular weight of 353.31 g/mol, XLogP of 2.31, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-methoxyphenyl)-2,4-dinitrobenzenesulfonamide is sourced from PubChem (CID 26952364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).