C13H20O — CID 26955
4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-one (PubChem CID 26955) has the molecular formula C13H20O and a molecular weight of 192.30 g/mol. Its IUPAC name is 4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-one.
| Compound Name | 4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-one |
|---|---|
| PubChem CID | 26955 |
| Molecular Formula | C13H20O |
| Molecular Weight | 192.30 g/mol |
| Exact Mass | 192.15 |
| IUPAC Name | 4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-one |
| SMILES | CC(=O)C=CC1=C(C)CCCC1(C)C |
| InChI | InChI=1S/C13H20O/c1-10-6-5-9-13(3,4)12(10)8-7-11(2)14/h7-8H,5-6,9H2,1-4H3 |
| InChIKey | PSQYTAPXSHCGMF-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.30 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|