About (2S)-6-bromo-2-hydroxy-3,4-dihydro-1H-naphthalene-2-sulfonic acid
(2S)-6-bromo-2-hydroxy-3,4-dihydro-1H-naphthalene-2-sulfonic acid (PubChem CID 26966639) has the molecular formula C10H11BrO4S
and a molecular weight of 307.17 g/mol. Its IUPAC name is (2S)-6-bromo-2-hydroxy-3,4-dihydro-1H-naphthalene-2-sulfonic acid.
Molecular Properties
| Compound Name | (2S)-6-bromo-2-hydroxy-3,4-dihydro-1H-naphthalene-2-sulfonic acid |
| PubChem CID | 26966639 |
| Molecular Formula | C10H11BrO4S |
| Molecular Weight | 307.17 g/mol |
| Exact Mass | 305.96 |
| IUPAC Name | (2S)-6-bromo-2-hydroxy-3,4-dihydro-1H-naphthalene-2-sulfonic acid |
| SMILES | O=S(=O)(O)[C@@]1(O)CCc2cc(Br)ccc2C1 |
| InChI | InChI=1S/C10H11BrO4S/c11-9-2-1-8-6-10(12,16(13,14)15)4-3-7(8)5-9/h1-2,5,12H,3-4,6H2,(H,13,14,15)/t10-/m0/s1 |
| InChIKey | VPJWSVHCRIMLLI-JTQLQIEISA-N |
| XLogP | 1.51 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.17 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze (2S)-6-bromo-2-hydroxy-3,4-dihydro-1H-naphthalene-2-sulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-6-bromo-2-hydroxy-3,4-dihydro-1H-naphthalene-2-sulfonic acid?
The IUPAC name of (2S)-6-bromo-2-hydroxy-3,4-dihydro-1H-naphthalene-2-sulfonic acid (CID 26966639) is (2S)-6-bromo-2-hydroxy-3,4-dihydro-1H-naphthalene-2-sulfonic acid.
What is the SMILES notation for (2S)-6-bromo-2-hydroxy-3,4-dihydro-1H-naphthalene-2-sulfonic acid?
The canonical SMILES for (2S)-6-bromo-2-hydroxy-3,4-dihydro-1H-naphthalene-2-sulfonic acid is O=S(=O)(O)[C@@]1(O)CCc2cc(Br)ccc2C1.
What is the InChIKey of (2S)-6-bromo-2-hydroxy-3,4-dihydro-1H-naphthalene-2-sulfonic acid?
The InChIKey is VPJWSVHCRIMLLI-JTQLQIEISA-N. The full InChI is InChI=1S/C10H11BrO4S/c11-9-2-1-8-6-10(12,16(13,14)15)4-3-7(8)5-9/h1-2,5,12H,3-4,6H2,(H,13,14,15)/t10-/m0/s1.
What are the key properties of (2S)-6-bromo-2-hydroxy-3,4-dihydro-1H-naphthalene-2-sulfonic acid?
(2S)-6-bromo-2-hydroxy-3,4-dihydro-1H-naphthalene-2-sulfonic acid has a molecular weight of 307.17 g/mol, XLogP of 1.51, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-6-bromo-2-hydroxy-3,4-dihydro-1H-naphthalene-2-sulfonic acid is sourced from PubChem (CID 26966639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).