C15H19N3O2S — CID 2696765
8-methyl-3-[(3-methylthiophen-2-yl)methylideneamino]-1,3-diazaspiro[4.5]decane-2,4-dione (PubChem CID 2696765) has the molecular formula C15H19N3O2S and a molecular weight of 305.40 g/mol. Its IUPAC name is 8-methyl-3-[(3-methylthiophen-2-yl)methylideneamino]-1,3-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | 8-methyl-3-[(3-methylthiophen-2-yl)methylideneamino]-1,3-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 2696765 |
| Molecular Formula | C15H19N3O2S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 8-methyl-3-[(3-methylthiophen-2-yl)methylideneamino]-1,3-diazaspiro[4.5]decane-2,4-dione |
| SMILES | Cc1ccsc1C=NN1C(=O)NC2(CCC(C)CC2)C1=O |
| InChI | InChI=1S/C15H19N3O2S/c1-10-3-6-15(7-4-10)13(19)18(14(20)17-15)16-9-12-11(2)5-8-21-12/h5,8-10H,3-4,6-7H2,1-2H3,(H,17,20) |
| InChIKey | PNNKUKRNJCQJJA-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|