C22H24O4 — CID 2697290
(2Z)-5,7-dimethyl-2-[(3,4,5-trimethoxyphenyl)methylidene]-3,4-dihydronaphthalen-1-one (PubChem CID 2697290) has the molecular formula C22H24O4 and a molecular weight of 352.43 g/mol. Its IUPAC name is (2Z)-5,7-dimethyl-2-[(3,4,5-trimethoxyphenyl)methylidene]-3,4-dihydronaphthalen-1-one.
| Compound Name | (2Z)-5,7-dimethyl-2-[(3,4,5-trimethoxyphenyl)methylidene]-3,4-dihydronaphthalen-1-one |
|---|---|
| PubChem CID | 2697290 |
| Molecular Formula | C22H24O4 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | (2Z)-5,7-dimethyl-2-[(3,4,5-trimethoxyphenyl)methylidene]-3,4-dihydronaphthalen-1-one |
| SMILES | COc1cc(/C=C2/CCc3c(C)cc(C)cc3C2=O)cc(OC)c1OC |
| InChI | InChI=1S/C22H24O4/c1-13-8-14(2)17-7-6-16(21(23)18(17)9-13)10-15-11-19(24-3)22(26-5)20(12-15)25-4/h8-12H,6-7H2,1-5H3/b16-10- |
| InChIKey | YTIXFRBSHWGZLF-YBEGLDIGSA-N |
| XLogP | 4.54 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|