About methyl 4-[(Z)-(5,7-dimethyl-1-oxo-3,4-dihydronaphthalen-2-ylidene)methyl]benzoate
methyl 4-[(Z)-(5,7-dimethyl-1-oxo-3,4-dihydronaphthalen-2-ylidene)methyl]benzoate (PubChem CID 2697308) has the molecular formula C21H20O3
and a molecular weight of 320.39 g/mol. Its IUPAC name is methyl 4-[(Z)-(5,7-dimethyl-1-oxo-3,4-dihydronaphthalen-2-ylidene)methyl]benzoate.
Molecular Properties
| Compound Name | methyl 4-[(Z)-(5,7-dimethyl-1-oxo-3,4-dihydronaphthalen-2-ylidene)methyl]benzoate |
| PubChem CID | 2697308 |
| Molecular Formula | C21H20O3 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | methyl 4-[(Z)-(5,7-dimethyl-1-oxo-3,4-dihydronaphthalen-2-ylidene)methyl]benzoate |
| SMILES | COC(=O)c1ccc(/C=C2/CCc3c(C)cc(C)cc3C2=O)cc1 |
| InChI | InChI=1S/C21H20O3/c1-13-10-14(2)18-9-8-17(20(22)19(18)11-13)12-15-4-6-16(7-5-15)21(23)24-3/h4-7,10-12H,8-9H2,1-3H3/b17-12- |
| InChIKey | IZWOSSORTJMCMW-ATVHPVEESA-N |
| XLogP | 4.30 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-[(Z)-(5,7-dimethyl-1-oxo-3,4-dihydronaphthalen-2-ylidene)methyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[(Z)-(5,7-dimethyl-1-oxo-3,4-dihydronaphthalen-2-ylidene)methyl]benzoate?
The IUPAC name of methyl 4-[(Z)-(5,7-dimethyl-1-oxo-3,4-dihydronaphthalen-2-ylidene)methyl]benzoate (CID 2697308) is methyl 4-[(Z)-(5,7-dimethyl-1-oxo-3,4-dihydronaphthalen-2-ylidene)methyl]benzoate.
What is the SMILES notation for methyl 4-[(Z)-(5,7-dimethyl-1-oxo-3,4-dihydronaphthalen-2-ylidene)methyl]benzoate?
The canonical SMILES for methyl 4-[(Z)-(5,7-dimethyl-1-oxo-3,4-dihydronaphthalen-2-ylidene)methyl]benzoate is COC(=O)c1ccc(/C=C2/CCc3c(C)cc(C)cc3C2=O)cc1.
What is the InChIKey of methyl 4-[(Z)-(5,7-dimethyl-1-oxo-3,4-dihydronaphthalen-2-ylidene)methyl]benzoate?
The InChIKey is IZWOSSORTJMCMW-ATVHPVEESA-N. The full InChI is InChI=1S/C21H20O3/c1-13-10-14(2)18-9-8-17(20(22)19(18)11-13)12-15-4-6-16(7-5-15)21(23)24-3/h4-7,10-12H,8-9H2,1-3H3/b17-12-.
What are the key properties of methyl 4-[(Z)-(5,7-dimethyl-1-oxo-3,4-dihydronaphthalen-2-ylidene)methyl]benzoate?
methyl 4-[(Z)-(5,7-dimethyl-1-oxo-3,4-dihydronaphthalen-2-ylidene)methyl]benzoate has a molecular weight of 320.39 g/mol, XLogP of 4.30, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[(Z)-(5,7-dimethyl-1-oxo-3,4-dihydronaphthalen-2-ylidene)methyl]benzoate is sourced from PubChem (CID 2697308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).