C21H25N2O3+ — CID 2697635
N-(1,3-benzodioxol-5-yl)-2-(4-benzylpiperidin-1-ium-1-yl)acetamide (PubChem CID 2697635) has the molecular formula C21H25N2O3+ and a molecular weight of 353.44 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-2-(4-benzylpiperidin-1-ium-1-yl)acetamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-2-(4-benzylpiperidin-1-ium-1-yl)acetamide |
|---|---|
| PubChem CID | 2697635 |
| Molecular Formula | C21H25N2O3+ |
| Molecular Weight | 353.44 g/mol |
| Exact Mass | 353.19 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-2-(4-benzylpiperidin-1-ium-1-yl)acetamide |
| SMILES | O=C(C[NH+]1CCC(Cc2ccccc2)CC1)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C21H24N2O3/c24-21(22-18-6-7-19-20(13-18)26-15-25-19)14-23-10-8-17(9-11-23)12-16-4-2-1-3-5-16/h1-7,13,17H,8-12,14-15H2,(H,22,24)/p+1 |
| InChIKey | YXRXOBSFGWSFJC-UHFFFAOYSA-O |
| XLogP | 1.89 |
| TPSA | 52.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.44 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |