C19H18Cl2F3N3O2 — CID 2698576
2-[[2-(2,6-dichloroanilino)-2-oxoethyl]-propylamino]-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 2698576) has the molecular formula C19H18Cl2F3N3O2 and a molecular weight of 448.27 g/mol. Its IUPAC name is 2-[[2-(2,6-dichloroanilino)-2-oxoethyl]-propylamino]-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | 2-[[2-(2,6-dichloroanilino)-2-oxoethyl]-propylamino]-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 2698576 |
| Molecular Formula | C19H18Cl2F3N3O2 |
| Molecular Weight | 448.27 g/mol |
| Exact Mass | 447.07 |
| IUPAC Name | 2-[[2-(2,6-dichloroanilino)-2-oxoethyl]-propylamino]-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | CCCN(CC(=O)Nc1ccc(F)c(F)c1F)CC(=O)Nc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C19H18Cl2F3N3O2/c1-2-8-27(10-16(29)26-19-11(20)4-3-5-12(19)21)9-15(28)25-14-7-6-13(22)17(23)18(14)24/h3-7H,2,8-10H2,1H3,(H,25,28)(H,26,29) |
| InChIKey | CVCVBNMBHLJEAB-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.27 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|