C6H6F7IO — CID 26985944
(2S,4S)-1,1,1,2-tetrafluoro-4-iodo-2-(trifluoromethoxy)pentane (PubChem CID 26985944) has the molecular formula C6H6F7IO and a molecular weight of 354.00 g/mol. Its IUPAC name is (2S,4S)-1,1,1,2-tetrafluoro-4-iodo-2-(trifluoromethoxy)pentane.
| Compound Name | (2S,4S)-1,1,1,2-tetrafluoro-4-iodo-2-(trifluoromethoxy)pentane |
|---|---|
| PubChem CID | 26985944 |
| Molecular Formula | C6H6F7IO |
| Molecular Weight | 354.00 g/mol |
| Exact Mass | 353.94 |
| IUPAC Name | (2S,4S)-1,1,1,2-tetrafluoro-4-iodo-2-(trifluoromethoxy)pentane |
| SMILES | C[C@H](I)C[C@@](F)(OC(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C6H6F7IO/c1-3(14)2-4(7,5(8,9)10)15-6(11,12)13/h3H,2H2,1H3/t3-,4+/m0/s1 |
| InChIKey | MGSMUGDXPQAOBJ-IUYQGCFVSA-N |
| XLogP | 3.96 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.00 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|