C21H21BrN2O2S — CID 26987407
(2S,5Z)-5-[(3-bromo-4-prop-2-enoxyphenyl)methylidene]-2-(4-ethylanilino)-1,3-thiazolidin-4-one (PubChem CID 26987407) has the molecular formula C21H21BrN2O2S and a molecular weight of 445.38 g/mol. Its IUPAC name is (2S,5Z)-5-[(3-bromo-4-prop-2-enoxyphenyl)methylidene]-2-(4-ethylanilino)-1,3-thiazolidin-4-one.
| Compound Name | (2S,5Z)-5-[(3-bromo-4-prop-2-enoxyphenyl)methylidene]-2-(4-ethylanilino)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 26987407 |
| Molecular Formula | C21H21BrN2O2S |
| Molecular Weight | 445.38 g/mol |
| Exact Mass | 444.05 |
| IUPAC Name | (2S,5Z)-5-[(3-bromo-4-prop-2-enoxyphenyl)methylidene]-2-(4-ethylanilino)-1,3-thiazolidin-4-one |
| SMILES | C=CCOc1ccc(/C=C2\S[C@@H](Nc3ccc(CC)cc3)NC2=O)cc1Br |
| InChI | InChI=1S/C21H21BrN2O2S/c1-3-11-26-18-10-7-15(12-17(18)22)13-19-20(25)24-21(27-19)23-16-8-5-14(4-2)6-9-16/h3,5-10,12-13,21,23H,1,4,11H2,2H3,(H,24,25)/b19-13-/t21-/m0/s1 |
| InChIKey | AMFZFKFGBQGKPC-FNGUVFISSA-N |
| XLogP | 5.18 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.38 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|