C22H18BrClN2O2S — CID 26987431
(2R,5Z)-5-[[5-(4-bromo-3-chlorophenyl)furan-2-yl]methylidene]-2-(4-ethylanilino)-1,3-thiazolidin-4-one (PubChem CID 26987431) has the molecular formula C22H18BrClN2O2S and a molecular weight of 489.82 g/mol. Its IUPAC name is (2R,5Z)-5-[[5-(4-bromo-3-chlorophenyl)furan-2-yl]methylidene]-2-(4-ethylanilino)-1,3-thiazolidin-4-one.
| Compound Name | (2R,5Z)-5-[[5-(4-bromo-3-chlorophenyl)furan-2-yl]methylidene]-2-(4-ethylanilino)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 26987431 |
| Molecular Formula | C22H18BrClN2O2S |
| Molecular Weight | 489.82 g/mol |
| Exact Mass | 488.00 |
| IUPAC Name | (2R,5Z)-5-[[5-(4-bromo-3-chlorophenyl)furan-2-yl]methylidene]-2-(4-ethylanilino)-1,3-thiazolidin-4-one |
| SMILES | CCc1ccc(N[C@@H]2NC(=O)/C(=C/c3ccc(-c4ccc(Br)c(Cl)c4)o3)S2)cc1 |
| InChI | InChI=1S/C22H18BrClN2O2S/c1-2-13-3-6-15(7-4-13)25-22-26-21(27)20(29-22)12-16-8-10-19(28-16)14-5-9-17(23)18(24)11-14/h3-12,22,25H,2H2,1H3,(H,26,27)/b20-12-/t22-/m1/s1 |
| InChIKey | AWJZJSKVBKXIHT-ZRELAVNMSA-N |
| XLogP | 6.52 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.82 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|