C20H30N2O8 — CID 26987924
(1S,2S,3R,4S,5R,6R)-3,6-bis[2-(dimethylamino)ethoxycarbonyl]bicyclo[2.2.2]oct-7-ene-2,5-dicarboxylic acid (PubChem CID 26987924) has the molecular formula C20H30N2O8 and a molecular weight of 426.47 g/mol. Its IUPAC name is (1S,2S,3R,4S,5R,6R)-3,6-bis[2-(dimethylamino)ethoxycarbonyl]bicyclo[2.2.2]oct-7-ene-2,5-dicarboxylic acid.
| Compound Name | (1S,2S,3R,4S,5R,6R)-3,6-bis[2-(dimethylamino)ethoxycarbonyl]bicyclo[2.2.2]oct-7-ene-2,5-dicarboxylic acid |
|---|---|
| PubChem CID | 26987924 |
| Molecular Formula | C20H30N2O8 |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.20 |
| IUPAC Name | (1S,2S,3R,4S,5R,6R)-3,6-bis[2-(dimethylamino)ethoxycarbonyl]bicyclo[2.2.2]oct-7-ene-2,5-dicarboxylic acid |
| SMILES | CN(C)CCOC(=O)[C@@H]1[C@H]2C=C[C@@H]([C@H]1C(=O)O)[C@@H](C(=O)OCCN(C)C)[C@H]2C(=O)O |
| InChI | InChI=1S/C20H30N2O8/c1-21(2)7-9-29-19(27)15-11-5-6-12(13(15)17(23)24)16(14(11)18(25)26)20(28)30-10-8-22(3)4/h5-6,11-16H,7-10H2,1-4H3,(H,23,24)(H,25,26)/t11-,12-,13-,14+,15+,16+/m0/s1 |
| InChIKey | KIOMUCOGULCZIB-YZXKGSGOSA-N |
| XLogP | -0.35 |
| TPSA | 133.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|