C18H20BrClN3O2+ — CID 2699212
[2-(2-bromo-4-methylanilino)-2-oxoethyl]-[2-(4-chloroanilino)-2-oxoethyl]-methylazanium (PubChem CID 2699212) has the molecular formula C18H20BrClN3O2+ and a molecular weight of 425.73 g/mol. Its IUPAC name is [2-(2-bromo-4-methylanilino)-2-oxoethyl]-[2-(4-chloroanilino)-2-oxoethyl]-methylazanium.
| Compound Name | [2-(2-bromo-4-methylanilino)-2-oxoethyl]-[2-(4-chloroanilino)-2-oxoethyl]-methylazanium |
|---|---|
| PubChem CID | 2699212 |
| Molecular Formula | C18H20BrClN3O2+ |
| Molecular Weight | 425.73 g/mol |
| Exact Mass | 424.04 |
| IUPAC Name | [2-(2-bromo-4-methylanilino)-2-oxoethyl]-[2-(4-chloroanilino)-2-oxoethyl]-methylazanium |
| SMILES | Cc1ccc(NC(=O)C[NH+](C)CC(=O)Nc2ccc(Cl)cc2)c(Br)c1 |
| InChI | InChI=1S/C18H19BrClN3O2/c1-12-3-8-16(15(19)9-12)22-18(25)11-23(2)10-17(24)21-14-6-4-13(20)5-7-14/h3-9H,10-11H2,1-2H3,(H,21,24)(H,22,25)/p+1 |
| InChIKey | PQYHJTFRLXQHNL-UHFFFAOYSA-O |
| XLogP | 2.50 |
| TPSA | 62.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.73 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |