C16H17ClN2O3 — CID 26996819
N'-[2-(4-chlorophenyl)acetyl]-2,4,5-trimethylfuran-3-carbohydrazide (PubChem CID 26996819) has the molecular formula C16H17ClN2O3 and a molecular weight of 320.78 g/mol. Its IUPAC name is N'-[2-(4-chlorophenyl)acetyl]-2,4,5-trimethylfuran-3-carbohydrazide.
| Compound Name | N'-[2-(4-chlorophenyl)acetyl]-2,4,5-trimethylfuran-3-carbohydrazide |
|---|---|
| PubChem CID | 26996819 |
| Molecular Formula | C16H17ClN2O3 |
| Molecular Weight | 320.78 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | N'-[2-(4-chlorophenyl)acetyl]-2,4,5-trimethylfuran-3-carbohydrazide |
| SMILES | Cc1oc(C)c(C(=O)NNC(=O)Cc2ccc(Cl)cc2)c1C |
| InChI | InChI=1S/C16H17ClN2O3/c1-9-10(2)22-11(3)15(9)16(21)19-18-14(20)8-12-4-6-13(17)7-5-12/h4-7H,8H2,1-3H3,(H,18,20)(H,19,21) |
| InChIKey | PBASZAYUZQQSIY-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.78 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|