About 2-nitropyridine
2-nitropyridine (PubChem CID 26998) has the molecular formula C5H4N2O2
and a molecular weight of 124.10 g/mol. Its IUPAC name is 2-nitropyridine.
Molecular Properties
| Compound Name | 2-nitropyridine |
| PubChem CID | 26998 |
| Molecular Formula | C5H4N2O2 |
| Molecular Weight | 124.10 g/mol |
| Exact Mass | 124.03 |
| IUPAC Name | 2-nitropyridine |
| SMILES | O=[N+]([O-])c1ccccn1 |
| InChI | InChI=1S/C5H4N2O2/c8-7(9)5-3-1-2-4-6-5/h1-4H |
| InChIKey | HLTDBMHJSBSAOM-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 56.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.10 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-nitropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-nitropyridine?
The IUPAC name of 2-nitropyridine (CID 26998) is 2-nitropyridine.
What is the SMILES notation for 2-nitropyridine?
The canonical SMILES for 2-nitropyridine is O=[N+]([O-])c1ccccn1.
What is the InChIKey of 2-nitropyridine?
The InChIKey is HLTDBMHJSBSAOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4N2O2/c8-7(9)5-3-1-2-4-6-5/h1-4H.
What are the key properties of 2-nitropyridine?
2-nitropyridine has a molecular weight of 124.10 g/mol, XLogP of 0.99, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-nitropyridine is sourced from PubChem (CID 26998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).