About 4-[(3R)-2-(4-bromophenyl)-5-(4-chlorophenyl)-3,4-dihydropyrazol-3-yl]-N,N-dimethylaniline
4-[(3R)-2-(4-bromophenyl)-5-(4-chlorophenyl)-3,4-dihydropyrazol-3-yl]-N,N-dimethylaniline (PubChem CID 27001120) has the molecular formula C23H21BrClN3
and a molecular weight of 454.80 g/mol. Its IUPAC name is 4-[(3R)-2-(4-bromophenyl)-5-(4-chlorophenyl)-3,4-dihydropyrazol-3-yl]-N,N-dimethylaniline.
Molecular Properties
| Compound Name | 4-[(3R)-2-(4-bromophenyl)-5-(4-chlorophenyl)-3,4-dihydropyrazol-3-yl]-N,N-dimethylaniline |
| PubChem CID | 27001120 |
| Molecular Formula | C23H21BrClN3 |
| Molecular Weight | 454.80 g/mol |
| Exact Mass | 453.06 |
| IUPAC Name | 4-[(3R)-2-(4-bromophenyl)-5-(4-chlorophenyl)-3,4-dihydropyrazol-3-yl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc([C@H]2CC(c3ccc(Cl)cc3)=NN2c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C23H21BrClN3/c1-27(2)20-11-5-17(6-12-20)23-15-22(16-3-9-19(25)10-4-16)26-28(23)21-13-7-18(24)8-14-21/h3-14,23H,15H2,1-2H3/t23-/m1/s1 |
| InChIKey | NRVUKHWBDNXCEG-HSZRJFAPSA-N |
| XLogP | 6.52 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 454.80 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|
Analyze 4-[(3R)-2-(4-bromophenyl)-5-(4-chlorophenyl)-3,4-dihydropyrazol-3-yl]-N,N-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(3R)-2-(4-bromophenyl)-5-(4-chlorophenyl)-3,4-dihydropyrazol-3-yl]-N,N-dimethylaniline?
The IUPAC name of 4-[(3R)-2-(4-bromophenyl)-5-(4-chlorophenyl)-3,4-dihydropyrazol-3-yl]-N,N-dimethylaniline (CID 27001120) is 4-[(3R)-2-(4-bromophenyl)-5-(4-chlorophenyl)-3,4-dihydropyrazol-3-yl]-N,N-dimethylaniline.
What is the SMILES notation for 4-[(3R)-2-(4-bromophenyl)-5-(4-chlorophenyl)-3,4-dihydropyrazol-3-yl]-N,N-dimethylaniline?
The canonical SMILES for 4-[(3R)-2-(4-bromophenyl)-5-(4-chlorophenyl)-3,4-dihydropyrazol-3-yl]-N,N-dimethylaniline is CN(C)c1ccc([C@H]2CC(c3ccc(Cl)cc3)=NN2c2ccc(Br)cc2)cc1.
What is the InChIKey of 4-[(3R)-2-(4-bromophenyl)-5-(4-chlorophenyl)-3,4-dihydropyrazol-3-yl]-N,N-dimethylaniline?
The InChIKey is NRVUKHWBDNXCEG-HSZRJFAPSA-N. The full InChI is InChI=1S/C23H21BrClN3/c1-27(2)20-11-5-17(6-12-20)23-15-22(16-3-9-19(25)10-4-16)26-28(23)21-13-7-18(24)8-14-21/h3-14,23H,15H2,1-2H3/t23-/m1/s1.
What are the key properties of 4-[(3R)-2-(4-bromophenyl)-5-(4-chlorophenyl)-3,4-dihydropyrazol-3-yl]-N,N-dimethylaniline?
4-[(3R)-2-(4-bromophenyl)-5-(4-chlorophenyl)-3,4-dihydropyrazol-3-yl]-N,N-dimethylaniline has a molecular weight of 454.80 g/mol, XLogP of 6.52, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3R)-2-(4-bromophenyl)-5-(4-chlorophenyl)-3,4-dihydropyrazol-3-yl]-N,N-dimethylaniline is sourced from PubChem (CID 27001120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).