C9H14N6O3S — CID 27001486
2-[[(4R,5S)-1,3-dimethyl-2,6-dioxo-5,7-dihydro-4H-purin-8-yl]sulfanyl]acetohydrazide (PubChem CID 27001486) has the molecular formula C9H14N6O3S and a molecular weight of 286.32 g/mol. Its IUPAC name is 2-[[(4R,5S)-1,3-dimethyl-2,6-dioxo-5,7-dihydro-4H-purin-8-yl]sulfanyl]acetohydrazide.
| Compound Name | 2-[[(4R,5S)-1,3-dimethyl-2,6-dioxo-5,7-dihydro-4H-purin-8-yl]sulfanyl]acetohydrazide |
|---|---|
| PubChem CID | 27001486 |
| Molecular Formula | C9H14N6O3S |
| Molecular Weight | 286.32 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | 2-[[(4R,5S)-1,3-dimethyl-2,6-dioxo-5,7-dihydro-4H-purin-8-yl]sulfanyl]acetohydrazide |
| SMILES | CN1C(=O)[C@H]2NC(SCC(=O)NN)=N[C@H]2N(C)C1=O |
| InChI | InChI=1S/C9H14N6O3S/c1-14-6-5(7(17)15(2)9(14)18)11-8(12-6)19-3-4(16)13-10/h5-6H,3,10H2,1-2H3,(H,11,12)(H,13,16)/t5-,6-/m0/s1 |
| InChIKey | DBGDARDPRZMVNA-WDSKDSINSA-N |
| XLogP | -2.11 |
| TPSA | 120.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.32 |
| LogP ≤ 5 | -2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|