C21H21FN4O2 — CID 27006126
3-[2-[4-(2-fluorophenyl)piperazin-1-yl]-2-oxoethyl]-8-methylquinazolin-4-one (PubChem CID 27006126) has the molecular formula C21H21FN4O2 and a molecular weight of 380.42 g/mol. Its IUPAC name is 3-[2-[4-(2-fluorophenyl)piperazin-1-yl]-2-oxoethyl]-8-methylquinazolin-4-one.
| Compound Name | 3-[2-[4-(2-fluorophenyl)piperazin-1-yl]-2-oxoethyl]-8-methylquinazolin-4-one |
|---|---|
| PubChem CID | 27006126 |
| Molecular Formula | C21H21FN4O2 |
| Molecular Weight | 380.42 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | 3-[2-[4-(2-fluorophenyl)piperazin-1-yl]-2-oxoethyl]-8-methylquinazolin-4-one |
| SMILES | Cc1cccc2c(=O)n(CC(=O)N3CCN(c4ccccc4F)CC3)cnc12 |
| InChI | InChI=1S/C21H21FN4O2/c1-15-5-4-6-16-20(15)23-14-26(21(16)28)13-19(27)25-11-9-24(10-12-25)18-8-3-2-7-17(18)22/h2-8,14H,9-13H2,1H3 |
| InChIKey | IDICPBNRQCYFHC-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.42 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |