C17H16IN3OS — CID 27009458
N-(3-iodo-4-methylphenyl)-1-methyl-4-(2-methyl-1,3-thiazol-4-yl)pyrrole-2-carboxamide (PubChem CID 27009458) has the molecular formula C17H16IN3OS and a molecular weight of 437.31 g/mol. Its IUPAC name is N-(3-iodo-4-methylphenyl)-1-methyl-4-(2-methyl-1,3-thiazol-4-yl)pyrrole-2-carboxamide.
| Compound Name | N-(3-iodo-4-methylphenyl)-1-methyl-4-(2-methyl-1,3-thiazol-4-yl)pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 27009458 |
| Molecular Formula | C17H16IN3OS |
| Molecular Weight | 437.31 g/mol |
| Exact Mass | 437.01 |
| IUPAC Name | N-(3-iodo-4-methylphenyl)-1-methyl-4-(2-methyl-1,3-thiazol-4-yl)pyrrole-2-carboxamide |
| SMILES | Cc1nc(-c2cc(C(=O)Nc3ccc(C)c(I)c3)n(C)c2)cs1 |
| InChI | InChI=1S/C17H16IN3OS/c1-10-4-5-13(7-14(10)18)20-17(22)16-6-12(8-21(16)3)15-9-23-11(2)19-15/h4-9H,1-3H3,(H,20,22) |
| InChIKey | AOZBQZOLPYNVAI-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.31 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|