C16H16ClNO5S — CID 27014139
methyl 2-(3-chloro-N-(4-methoxyphenyl)sulfonylanilino)acetate (PubChem CID 27014139) has the molecular formula C16H16ClNO5S and a molecular weight of 369.83 g/mol. Its IUPAC name is methyl 2-(3-chloro-N-(4-methoxyphenyl)sulfonylanilino)acetate.
| Compound Name | methyl 2-(3-chloro-N-(4-methoxyphenyl)sulfonylanilino)acetate |
|---|---|
| PubChem CID | 27014139 |
| Molecular Formula | C16H16ClNO5S |
| Molecular Weight | 369.83 g/mol |
| Exact Mass | 369.04 |
| IUPAC Name | methyl 2-(3-chloro-N-(4-methoxyphenyl)sulfonylanilino)acetate |
| SMILES | COC(=O)CN(c1cccc(Cl)c1)S(=O)(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C16H16ClNO5S/c1-22-14-6-8-15(9-7-14)24(20,21)18(11-16(19)23-2)13-5-3-4-12(17)10-13/h3-10H,11H2,1-2H3 |
| InChIKey | HNNSODMBIJFWFN-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.83 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |