C15H13N5O2S — CID 27018091
1-(2,1,3-benzothiadiazol-5-yl)-3-[(Z)-(2-methoxyphenyl)methylideneamino]urea (PubChem CID 27018091) has the molecular formula C15H13N5O2S and a molecular weight of 327.37 g/mol. Its IUPAC name is 1-(2,1,3-benzothiadiazol-5-yl)-3-[(Z)-(2-methoxyphenyl)methylideneamino]urea.
| Compound Name | 1-(2,1,3-benzothiadiazol-5-yl)-3-[(Z)-(2-methoxyphenyl)methylideneamino]urea |
|---|---|
| PubChem CID | 27018091 |
| Molecular Formula | C15H13N5O2S |
| Molecular Weight | 327.37 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | 1-(2,1,3-benzothiadiazol-5-yl)-3-[(Z)-(2-methoxyphenyl)methylideneamino]urea |
| SMILES | COc1ccccc1/C=N\NC(=O)Nc1ccc2nsnc2c1 |
| InChI | InChI=1S/C15H13N5O2S/c1-22-14-5-3-2-4-10(14)9-16-18-15(21)17-11-6-7-12-13(8-11)20-23-19-12/h2-9H,1H3,(H2,17,18,21)/b16-9- |
| InChIKey | CIHADROWAQJAAO-SXGWCWSVSA-N |
| XLogP | 2.86 |
| TPSA | 88.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.37 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|