C21H20BrN3O3S — CID 27018737
6-(3-bromophenyl)-N-[4-(dimethylsulfamoyl)phenyl]-2-methylpyridine-3-carboxamide (PubChem CID 27018737) has the molecular formula C21H20BrN3O3S and a molecular weight of 474.38 g/mol. Its IUPAC name is 6-(3-bromophenyl)-N-[4-(dimethylsulfamoyl)phenyl]-2-methylpyridine-3-carboxamide.
| Compound Name | 6-(3-bromophenyl)-N-[4-(dimethylsulfamoyl)phenyl]-2-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 27018737 |
| Molecular Formula | C21H20BrN3O3S |
| Molecular Weight | 474.38 g/mol |
| Exact Mass | 473.04 |
| IUPAC Name | 6-(3-bromophenyl)-N-[4-(dimethylsulfamoyl)phenyl]-2-methylpyridine-3-carboxamide |
| SMILES | Cc1nc(-c2cccc(Br)c2)ccc1C(=O)Nc1ccc(S(=O)(=O)N(C)C)cc1 |
| InChI | InChI=1S/C21H20BrN3O3S/c1-14-19(11-12-20(23-14)15-5-4-6-16(22)13-15)21(26)24-17-7-9-18(10-8-17)29(27,28)25(2)3/h4-13H,1-3H3,(H,24,26) |
| InChIKey | DXCVDHMWSWCKTB-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.38 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |