C17H20O — CID 27021
3-benzylidene-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one (PubChem CID 27021) has the molecular formula C17H20O and a molecular weight of 240.35 g/mol. Its IUPAC name is 3-benzylidene-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one.
| Compound Name | 3-benzylidene-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one |
|---|---|
| PubChem CID | 27021 |
| Molecular Formula | C17H20O |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | 3-benzylidene-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one |
| SMILES | CC12CCC(C(=Cc3ccccc3)C1=O)C2(C)C |
| InChI | InChI=1S/C17H20O/c1-16(2)14-9-10-17(16,3)15(18)13(14)11-12-7-5-4-6-8-12/h4-8,11,14H,9-10H2,1-3H3 |
| InChIKey | OIQXFRANQVWXJF-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|