C19H24N2O4S — CID 27021904
4-[2-(methanesulfonamido)ethyl]-N-[2-(3-methylphenoxy)ethyl]benzamide (PubChem CID 27021904) has the molecular formula C19H24N2O4S and a molecular weight of 376.48 g/mol. Its IUPAC name is 4-[2-(methanesulfonamido)ethyl]-N-[2-(3-methylphenoxy)ethyl]benzamide.
| Compound Name | 4-[2-(methanesulfonamido)ethyl]-N-[2-(3-methylphenoxy)ethyl]benzamide |
|---|---|
| PubChem CID | 27021904 |
| Molecular Formula | C19H24N2O4S |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | 4-[2-(methanesulfonamido)ethyl]-N-[2-(3-methylphenoxy)ethyl]benzamide |
| SMILES | Cc1cccc(OCCNC(=O)c2ccc(CCNS(C)(=O)=O)cc2)c1 |
| InChI | InChI=1S/C19H24N2O4S/c1-15-4-3-5-18(14-15)25-13-12-20-19(22)17-8-6-16(7-9-17)10-11-21-26(2,23)24/h3-9,14,21H,10-13H2,1-2H3,(H,20,22) |
| InChIKey | RUHLLQUBYOHGDX-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|