C26H37N3O3 — CID 27026246
(2S)-1-(2-amino-4-cyclohexylphenoxy)-3-[4-(2-methoxyphenyl)piperazin-1-yl]propan-2-ol (PubChem CID 27026246) has the molecular formula C26H37N3O3 and a molecular weight of 439.60 g/mol. Its IUPAC name is (2S)-1-(2-amino-4-cyclohexylphenoxy)-3-[4-(2-methoxyphenyl)piperazin-1-yl]propan-2-ol.
| Compound Name | (2S)-1-(2-amino-4-cyclohexylphenoxy)-3-[4-(2-methoxyphenyl)piperazin-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 27026246 |
| Molecular Formula | C26H37N3O3 |
| Molecular Weight | 439.60 g/mol |
| Exact Mass | 439.28 |
| IUPAC Name | (2S)-1-(2-amino-4-cyclohexylphenoxy)-3-[4-(2-methoxyphenyl)piperazin-1-yl]propan-2-ol |
| SMILES | COc1ccccc1N1CCN(C[C@H](O)COc2ccc(C3CCCCC3)cc2N)CC1 |
| InChI | InChI=1S/C26H37N3O3/c1-31-26-10-6-5-9-24(26)29-15-13-28(14-16-29)18-22(30)19-32-25-12-11-21(17-23(25)27)20-7-3-2-4-8-20/h5-6,9-12,17,20,22,30H,2-4,7-8,13-16,18-19,27H2,1H3/t22-/m0/s1 |
| InChIKey | KHHIVPICUHVJBC-QFIPXVFZSA-N |
| XLogP | 3.89 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.60 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|