About N-(3-methylsulfanyl-1H-1,2,4-triazol-5-yl)methanesulfonamide
N-(3-methylsulfanyl-1H-1,2,4-triazol-5-yl)methanesulfonamide (PubChem CID 27026525) has the molecular formula C4H8N4O2S2
and a molecular weight of 208.27 g/mol. Its IUPAC name is N-(3-methylsulfanyl-1H-1,2,4-triazol-5-yl)methanesulfonamide.
Molecular Properties
| Compound Name | N-(3-methylsulfanyl-1H-1,2,4-triazol-5-yl)methanesulfonamide |
| PubChem CID | 27026525 |
| Molecular Formula | C4H8N4O2S2 |
| Molecular Weight | 208.27 g/mol |
| Exact Mass | 208.01 |
| IUPAC Name | N-(3-methylsulfanyl-1H-1,2,4-triazol-5-yl)methanesulfonamide |
| SMILES | CSc1n[nH]c(NS(C)(=O)=O)n1 |
| InChI | InChI=1S/C4H8N4O2S2/c1-11-4-5-3(6-7-4)8-12(2,9)10/h1-2H3,(H2,5,6,7,8) |
| InChIKey | JJXZRFWTWUFQKW-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.27 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(3-methylsulfanyl-1H-1,2,4-triazol-5-yl)methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-methylsulfanyl-1H-1,2,4-triazol-5-yl)methanesulfonamide?
The IUPAC name of N-(3-methylsulfanyl-1H-1,2,4-triazol-5-yl)methanesulfonamide (CID 27026525) is N-(3-methylsulfanyl-1H-1,2,4-triazol-5-yl)methanesulfonamide.
What is the SMILES notation for N-(3-methylsulfanyl-1H-1,2,4-triazol-5-yl)methanesulfonamide?
The canonical SMILES for N-(3-methylsulfanyl-1H-1,2,4-triazol-5-yl)methanesulfonamide is CSc1n[nH]c(NS(C)(=O)=O)n1.
What is the InChIKey of N-(3-methylsulfanyl-1H-1,2,4-triazol-5-yl)methanesulfonamide?
The InChIKey is JJXZRFWTWUFQKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8N4O2S2/c1-11-4-5-3(6-7-4)8-12(2,9)10/h1-2H3,(H2,5,6,7,8).
What are the key properties of N-(3-methylsulfanyl-1H-1,2,4-triazol-5-yl)methanesulfonamide?
N-(3-methylsulfanyl-1H-1,2,4-triazol-5-yl)methanesulfonamide has a molecular weight of 208.27 g/mol, XLogP of -0.10, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-methylsulfanyl-1H-1,2,4-triazol-5-yl)methanesulfonamide is sourced from PubChem (CID 27026525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).