C20H19F3N6O5 — CID 27030472
[2-(2-methyl-5-nitroanilino)-2-oxoethyl] 3-[5,7-dimethyl-2-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]propanoate (PubChem CID 27030472) has the molecular formula C20H19F3N6O5 and a molecular weight of 480.40 g/mol. Its IUPAC name is [2-(2-methyl-5-nitroanilino)-2-oxoethyl] 3-[5,7-dimethyl-2-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]propanoate.
| Compound Name | [2-(2-methyl-5-nitroanilino)-2-oxoethyl] 3-[5,7-dimethyl-2-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]propanoate |
|---|---|
| PubChem CID | 27030472 |
| Molecular Formula | C20H19F3N6O5 |
| Molecular Weight | 480.40 g/mol |
| Exact Mass | 480.14 |
| IUPAC Name | [2-(2-methyl-5-nitroanilino)-2-oxoethyl] 3-[5,7-dimethyl-2-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]propanoate |
| SMILES | Cc1ccc([N+](=O)[O-])cc1NC(=O)COC(=O)CCc1c(C)nc2nc(C(F)(F)F)nn2c1C |
| InChI | InChI=1S/C20H19F3N6O5/c1-10-4-5-13(29(32)33)8-15(10)25-16(30)9-34-17(31)7-6-14-11(2)24-19-26-18(20(21,22)23)27-28(19)12(14)3/h4-5,8H,6-7,9H2,1-3H3,(H,25,30) |
| InChIKey | DNDVNQURODICFA-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 141.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.40 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|