C20H23FN4O3 — CID 27035695
1-[4-(4-acetyl-2-fluorophenyl)piperazin-1-yl]-2-(1,3,5-trimethylpyrazol-4-yl)ethane-1,2-dione (PubChem CID 27035695) has the molecular formula C20H23FN4O3 and a molecular weight of 386.43 g/mol. Its IUPAC name is 1-[4-(4-acetyl-2-fluorophenyl)piperazin-1-yl]-2-(1,3,5-trimethylpyrazol-4-yl)ethane-1,2-dione.
| Compound Name | 1-[4-(4-acetyl-2-fluorophenyl)piperazin-1-yl]-2-(1,3,5-trimethylpyrazol-4-yl)ethane-1,2-dione |
|---|---|
| PubChem CID | 27035695 |
| Molecular Formula | C20H23FN4O3 |
| Molecular Weight | 386.43 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | 1-[4-(4-acetyl-2-fluorophenyl)piperazin-1-yl]-2-(1,3,5-trimethylpyrazol-4-yl)ethane-1,2-dione |
| SMILES | CC(=O)c1ccc(N2CCN(C(=O)C(=O)c3c(C)nn(C)c3C)CC2)c(F)c1 |
| InChI | InChI=1S/C20H23FN4O3/c1-12-18(13(2)23(4)22-12)19(27)20(28)25-9-7-24(8-10-25)17-6-5-15(14(3)26)11-16(17)21/h5-6,11H,7-10H2,1-4H3 |
| InChIKey | BKRSHFWPBZEWEP-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 75.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.43 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|