About 3-methylpyrazolo[4,3-b]quinoxaline-1-carbothioamide
3-methylpyrazolo[4,3-b]quinoxaline-1-carbothioamide (PubChem CID 27036296) has the molecular formula C11H9N5S
and a molecular weight of 243.30 g/mol. Its IUPAC name is 3-methylpyrazolo[4,3-b]quinoxaline-1-carbothioamide.
Molecular Properties
| Compound Name | 3-methylpyrazolo[4,3-b]quinoxaline-1-carbothioamide |
| PubChem CID | 27036296 |
| Molecular Formula | C11H9N5S |
| Molecular Weight | 243.30 g/mol |
| Exact Mass | 243.06 |
| IUPAC Name | 3-methylpyrazolo[4,3-b]quinoxaline-1-carbothioamide |
| SMILES | Cc1nn(C(N)=S)c2nc3ccccc3nc12 |
| InChI | InChI=1S/C11H9N5S/c1-6-9-10(16(15-6)11(12)17)14-8-5-3-2-4-7(8)13-9/h2-5H,1H3,(H2,12,17) |
| InChIKey | BMWYVMIAJZUDRJ-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.30 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-methylpyrazolo[4,3-b]quinoxaline-1-carbothioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylpyrazolo[4,3-b]quinoxaline-1-carbothioamide?
The IUPAC name of 3-methylpyrazolo[4,3-b]quinoxaline-1-carbothioamide (CID 27036296) is 3-methylpyrazolo[4,3-b]quinoxaline-1-carbothioamide.
What is the SMILES notation for 3-methylpyrazolo[4,3-b]quinoxaline-1-carbothioamide?
The canonical SMILES for 3-methylpyrazolo[4,3-b]quinoxaline-1-carbothioamide is Cc1nn(C(N)=S)c2nc3ccccc3nc12.
What is the InChIKey of 3-methylpyrazolo[4,3-b]quinoxaline-1-carbothioamide?
The InChIKey is BMWYVMIAJZUDRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9N5S/c1-6-9-10(16(15-6)11(12)17)14-8-5-3-2-4-7(8)13-9/h2-5H,1H3,(H2,12,17).
What are the key properties of 3-methylpyrazolo[4,3-b]quinoxaline-1-carbothioamide?
3-methylpyrazolo[4,3-b]quinoxaline-1-carbothioamide has a molecular weight of 243.30 g/mol, XLogP of 1.38, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylpyrazolo[4,3-b]quinoxaline-1-carbothioamide is sourced from PubChem (CID 27036296), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).