About 2-(3-methylpyrazolo[4,3-b]quinoxalin-1-yl)-1,3-thiazole
2-(3-methylpyrazolo[4,3-b]quinoxalin-1-yl)-1,3-thiazole (PubChem CID 27036330) has the molecular formula C13H9N5S
and a molecular weight of 267.32 g/mol. Its IUPAC name is 2-(3-methylpyrazolo[4,3-b]quinoxalin-1-yl)-1,3-thiazole.
Molecular Properties
| Compound Name | 2-(3-methylpyrazolo[4,3-b]quinoxalin-1-yl)-1,3-thiazole |
| PubChem CID | 27036330 |
| Molecular Formula | C13H9N5S |
| Molecular Weight | 267.32 g/mol |
| Exact Mass | 267.06 |
| IUPAC Name | 2-(3-methylpyrazolo[4,3-b]quinoxalin-1-yl)-1,3-thiazole |
| SMILES | Cc1nn(-c2nccs2)c2nc3ccccc3nc12 |
| InChI | InChI=1S/C13H9N5S/c1-8-11-12(18(17-8)13-14-6-7-19-13)16-10-5-3-2-4-9(10)15-11/h2-7H,1H3 |
| InChIKey | JXHHNWGVXYPQLZ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.32 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(3-methylpyrazolo[4,3-b]quinoxalin-1-yl)-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-methylpyrazolo[4,3-b]quinoxalin-1-yl)-1,3-thiazole?
The IUPAC name of 2-(3-methylpyrazolo[4,3-b]quinoxalin-1-yl)-1,3-thiazole (CID 27036330) is 2-(3-methylpyrazolo[4,3-b]quinoxalin-1-yl)-1,3-thiazole.
What is the SMILES notation for 2-(3-methylpyrazolo[4,3-b]quinoxalin-1-yl)-1,3-thiazole?
The canonical SMILES for 2-(3-methylpyrazolo[4,3-b]quinoxalin-1-yl)-1,3-thiazole is Cc1nn(-c2nccs2)c2nc3ccccc3nc12.
What is the InChIKey of 2-(3-methylpyrazolo[4,3-b]quinoxalin-1-yl)-1,3-thiazole?
The InChIKey is JXHHNWGVXYPQLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9N5S/c1-8-11-12(18(17-8)13-14-6-7-19-13)16-10-5-3-2-4-9(10)15-11/h2-7H,1H3.
What are the key properties of 2-(3-methylpyrazolo[4,3-b]quinoxalin-1-yl)-1,3-thiazole?
2-(3-methylpyrazolo[4,3-b]quinoxalin-1-yl)-1,3-thiazole has a molecular weight of 267.32 g/mol, XLogP of 2.73, 1 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-methylpyrazolo[4,3-b]quinoxalin-1-yl)-1,3-thiazole is sourced from PubChem (CID 27036330), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).