C26H24ClN5O3 — CID 27041389
[3-cyano-3-(1,3-dimethylbenzimidazol-2-ylidene)-2-oxopropyl] 5-chloro-3-methyl-1-[(4-methylphenyl)methyl]pyrazole-4-carboxylate (PubChem CID 27041389) has the molecular formula C26H24ClN5O3 and a molecular weight of 489.96 g/mol. Its IUPAC name is [3-cyano-3-(1,3-dimethylbenzimidazol-2-ylidene)-2-oxopropyl] 5-chloro-3-methyl-1-[(4-methylphenyl)methyl]pyrazole-4-carboxylate.
| Compound Name | [3-cyano-3-(1,3-dimethylbenzimidazol-2-ylidene)-2-oxopropyl] 5-chloro-3-methyl-1-[(4-methylphenyl)methyl]pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 27041389 |
| Molecular Formula | C26H24ClN5O3 |
| Molecular Weight | 489.96 g/mol |
| Exact Mass | 489.16 |
| IUPAC Name | [3-cyano-3-(1,3-dimethylbenzimidazol-2-ylidene)-2-oxopropyl] 5-chloro-3-methyl-1-[(4-methylphenyl)methyl]pyrazole-4-carboxylate |
| SMILES | Cc1ccc(Cn2nc(C)c(C(=O)OCC(=O)C(C#N)=C3N(C)c4ccccc4N3C)c2Cl)cc1 |
| InChI | InChI=1S/C26H24ClN5O3/c1-16-9-11-18(12-10-16)14-32-24(27)23(17(2)29-32)26(34)35-15-22(33)19(13-28)25-30(3)20-7-5-6-8-21(20)31(25)4/h5-12H,14-15H2,1-4H3 |
| InChIKey | DSTAUQRPBGISKH-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 91.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.96 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|