C31H25NO4 — CID 27046989
(2S,3R)-3-benzhydryl-1-(4-methylphenyl)-4,5-dioxo-2-phenylpyrrolidine-3-carboxylic acid (PubChem CID 27046989) has the molecular formula C31H25NO4 and a molecular weight of 475.54 g/mol. Its IUPAC name is (2S,3R)-3-benzhydryl-1-(4-methylphenyl)-4,5-dioxo-2-phenylpyrrolidine-3-carboxylic acid.
| Compound Name | (2S,3R)-3-benzhydryl-1-(4-methylphenyl)-4,5-dioxo-2-phenylpyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 27046989 |
| Molecular Formula | C31H25NO4 |
| Molecular Weight | 475.54 g/mol |
| Exact Mass | 475.18 |
| IUPAC Name | (2S,3R)-3-benzhydryl-1-(4-methylphenyl)-4,5-dioxo-2-phenylpyrrolidine-3-carboxylic acid |
| SMILES | Cc1ccc(N2C(=O)C(=O)[C@@](C(=O)O)(C(c3ccccc3)c3ccccc3)[C@@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C31H25NO4/c1-21-17-19-25(20-18-21)32-27(24-15-9-4-10-16-24)31(30(35)36,28(33)29(32)34)26(22-11-5-2-6-12-22)23-13-7-3-8-14-23/h2-20,26-27H,1H3,(H,35,36)/t27-,31+/m0/s1 |
| InChIKey | NPFKNCOPJQPVNK-JTSJOTPCSA-N |
| XLogP | 5.56 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.54 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|