C25H22N4O5 — CID 27047114
(5S)-1-(3-methylphenyl)-5-[(4-nitrophenyl)methyl]-5-(2-pyridin-4-ylethyl)-1,3-diazinane-2,4,6-trione (PubChem CID 27047114) has the molecular formula C25H22N4O5 and a molecular weight of 458.47 g/mol. Its IUPAC name is (5S)-1-(3-methylphenyl)-5-[(4-nitrophenyl)methyl]-5-(2-pyridin-4-ylethyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | (5S)-1-(3-methylphenyl)-5-[(4-nitrophenyl)methyl]-5-(2-pyridin-4-ylethyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 27047114 |
| Molecular Formula | C25H22N4O5 |
| Molecular Weight | 458.47 g/mol |
| Exact Mass | 458.16 |
| IUPAC Name | (5S)-1-(3-methylphenyl)-5-[(4-nitrophenyl)methyl]-5-(2-pyridin-4-ylethyl)-1,3-diazinane-2,4,6-trione |
| SMILES | Cc1cccc(N2C(=O)NC(=O)[C@](CCc3ccncc3)(Cc3ccc([N+](=O)[O-])cc3)C2=O)c1 |
| InChI | InChI=1S/C25H22N4O5/c1-17-3-2-4-21(15-17)28-23(31)25(22(30)27-24(28)32,12-9-18-10-13-26-14-11-18)16-19-5-7-20(8-6-19)29(33)34/h2-8,10-11,13-15H,9,12,16H2,1H3,(H,27,30,32)/t25-/m0/s1 |
| InChIKey | AKUSGWWYFQHBJF-VWLOTQADSA-N |
| XLogP | 3.74 |
| TPSA | 122.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.47 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|