About S-(4-nitrophenyl) ethanethioate
S-(4-nitrophenyl) ethanethioate (PubChem CID 27050) has the molecular formula C8H7NO3S
and a molecular weight of 197.22 g/mol. Its IUPAC name is S-(4-nitrophenyl) ethanethioate.
Molecular Properties
| Compound Name | S-(4-nitrophenyl) ethanethioate |
| PubChem CID | 27050 |
| Molecular Formula | C8H7NO3S |
| Molecular Weight | 197.22 g/mol |
| Exact Mass | 197.01 |
| IUPAC Name | S-(4-nitrophenyl) ethanethioate |
| SMILES | CC(=O)Sc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C8H7NO3S/c1-6(10)13-8-4-2-7(3-5-8)9(11)12/h2-5H,1H3 |
| InChIKey | QCGPFSMQZNLBCA-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.22 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(4-nitrophenyl) ethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(4-nitrophenyl) ethanethioate?
The IUPAC name of S-(4-nitrophenyl) ethanethioate (CID 27050) is S-(4-nitrophenyl) ethanethioate.
What is the SMILES notation for S-(4-nitrophenyl) ethanethioate?
The canonical SMILES for S-(4-nitrophenyl) ethanethioate is CC(=O)Sc1ccc([N+](=O)[O-])cc1.
What is the InChIKey of S-(4-nitrophenyl) ethanethioate?
The InChIKey is QCGPFSMQZNLBCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NO3S/c1-6(10)13-8-4-2-7(3-5-8)9(11)12/h2-5H,1H3.
What are the key properties of S-(4-nitrophenyl) ethanethioate?
S-(4-nitrophenyl) ethanethioate has a molecular weight of 197.22 g/mol, XLogP of 2.23, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for S-(4-nitrophenyl) ethanethioate is sourced from PubChem (CID 27050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).