C17H13F4NO3 — CID 27055413
2,2,3,3-tetrafluoropropyl (E)-4-(naphthalen-1-ylamino)-4-oxobut-2-enoate (PubChem CID 27055413) has the molecular formula C17H13F4NO3 and a molecular weight of 355.29 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoropropyl (E)-4-(naphthalen-1-ylamino)-4-oxobut-2-enoate.
| Compound Name | 2,2,3,3-tetrafluoropropyl (E)-4-(naphthalen-1-ylamino)-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 27055413 |
| Molecular Formula | C17H13F4NO3 |
| Molecular Weight | 355.29 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | 2,2,3,3-tetrafluoropropyl (E)-4-(naphthalen-1-ylamino)-4-oxobut-2-enoate |
| SMILES | O=C(/C=C/C(=O)OCC(F)(F)C(F)F)Nc1cccc2ccccc12 |
| InChI | InChI=1S/C17H13F4NO3/c18-16(19)17(20,21)10-25-15(24)9-8-14(23)22-13-7-3-5-11-4-1-2-6-12(11)13/h1-9,16H,10H2,(H,22,23)/b9-8+ |
| InChIKey | OXANBZDSMQUSGQ-CMDGGOBGSA-N |
| XLogP | 3.78 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.29 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|