About 2-[[4-(2,4-difluorophenyl)-5-[1-(4-methylphenyl)tetrazol-5-yl]pyrimidin-2-yl]amino]acetic acid
2-[[4-(2,4-difluorophenyl)-5-[1-(4-methylphenyl)tetrazol-5-yl]pyrimidin-2-yl]amino]acetic acid (PubChem CID 27056141) has the molecular formula C20H15F2N7O2
and a molecular weight of 423.38 g/mol. Its IUPAC name is 2-[[4-(2,4-difluorophenyl)-5-[1-(4-methylphenyl)tetrazol-5-yl]pyrimidin-2-yl]amino]acetic acid.
Molecular Properties
| Compound Name | 2-[[4-(2,4-difluorophenyl)-5-[1-(4-methylphenyl)tetrazol-5-yl]pyrimidin-2-yl]amino]acetic acid |
| PubChem CID | 27056141 |
| Molecular Formula | C20H15F2N7O2 |
| Molecular Weight | 423.38 g/mol |
| Exact Mass | 423.13 |
| IUPAC Name | 2-[[4-(2,4-difluorophenyl)-5-[1-(4-methylphenyl)tetrazol-5-yl]pyrimidin-2-yl]amino]acetic acid |
| SMILES | Cc1ccc(-n2nnnc2-c2cnc(NCC(=O)O)nc2-c2ccc(F)cc2F)cc1 |
| InChI | InChI=1S/C20H15F2N7O2/c1-11-2-5-13(6-3-11)29-19(26-27-28-29)15-9-23-20(24-10-17(30)31)25-18(15)14-7-4-12(21)8-16(14)22/h2-9H,10H2,1H3,(H,30,31)(H,23,24,25) |
| InChIKey | CJMMRLGUHNZDKQ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 118.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 423.38 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 2-[[4-(2,4-difluorophenyl)-5-[1-(4-methylphenyl)tetrazol-5-yl]pyrimidin-2-yl]amino]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[4-(2,4-difluorophenyl)-5-[1-(4-methylphenyl)tetrazol-5-yl]pyrimidin-2-yl]amino]acetic acid?
The IUPAC name of 2-[[4-(2,4-difluorophenyl)-5-[1-(4-methylphenyl)tetrazol-5-yl]pyrimidin-2-yl]amino]acetic acid (CID 27056141) is 2-[[4-(2,4-difluorophenyl)-5-[1-(4-methylphenyl)tetrazol-5-yl]pyrimidin-2-yl]amino]acetic acid.
What is the SMILES notation for 2-[[4-(2,4-difluorophenyl)-5-[1-(4-methylphenyl)tetrazol-5-yl]pyrimidin-2-yl]amino]acetic acid?
The canonical SMILES for 2-[[4-(2,4-difluorophenyl)-5-[1-(4-methylphenyl)tetrazol-5-yl]pyrimidin-2-yl]amino]acetic acid is Cc1ccc(-n2nnnc2-c2cnc(NCC(=O)O)nc2-c2ccc(F)cc2F)cc1.
What is the InChIKey of 2-[[4-(2,4-difluorophenyl)-5-[1-(4-methylphenyl)tetrazol-5-yl]pyrimidin-2-yl]amino]acetic acid?
The InChIKey is CJMMRLGUHNZDKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15F2N7O2/c1-11-2-5-13(6-3-11)29-19(26-27-28-29)15-9-23-20(24-10-17(30)31)25-18(15)14-7-4-12(21)8-16(14)22/h2-9H,10H2,1H3,(H,30,31)(H,23,24,25).
What are the key properties of 2-[[4-(2,4-difluorophenyl)-5-[1-(4-methylphenyl)tetrazol-5-yl]pyrimidin-2-yl]amino]acetic acid?
2-[[4-(2,4-difluorophenyl)-5-[1-(4-methylphenyl)tetrazol-5-yl]pyrimidin-2-yl]amino]acetic acid has a molecular weight of 423.38 g/mol, XLogP of 2.87, 6 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[4-(2,4-difluorophenyl)-5-[1-(4-methylphenyl)tetrazol-5-yl]pyrimidin-2-yl]amino]acetic acid is sourced from PubChem (CID 27056141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).