About 2-nitropyridin-3-ol
2-nitropyridin-3-ol (PubChem CID 27057) has the molecular formula C5H4N2O3
and a molecular weight of 140.10 g/mol. Its IUPAC name is 2-nitropyridin-3-ol.
Molecular Properties
| Compound Name | 2-nitropyridin-3-ol |
| PubChem CID | 27057 |
| Molecular Formula | C5H4N2O3 |
| Molecular Weight | 140.10 g/mol |
| Exact Mass | 140.02 |
| IUPAC Name | 2-nitropyridin-3-ol |
| SMILES | O=[N+]([O-])c1ncccc1O |
| InChI | InChI=1S/C5H4N2O3/c8-4-2-1-3-6-5(4)7(9)10/h1-3,8H |
| InChIKey | QBPDSKPWYWIHGA-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 76.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.10 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-nitropyridin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-nitropyridin-3-ol?
The IUPAC name of 2-nitropyridin-3-ol (CID 27057) is 2-nitropyridin-3-ol.
What is the SMILES notation for 2-nitropyridin-3-ol?
The canonical SMILES for 2-nitropyridin-3-ol is O=[N+]([O-])c1ncccc1O.
What is the InChIKey of 2-nitropyridin-3-ol?
The InChIKey is QBPDSKPWYWIHGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4N2O3/c8-4-2-1-3-6-5(4)7(9)10/h1-3,8H.
What are the key properties of 2-nitropyridin-3-ol?
2-nitropyridin-3-ol has a molecular weight of 140.10 g/mol, XLogP of 0.70, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-nitropyridin-3-ol is sourced from PubChem (CID 27057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).