C28H31NO6 — CID 27058155
diethyl (1S,2R,3R,4S)-2-(1-benzylindol-3-yl)-4-hydroxy-4-methyl-6-oxocyclohexane-1,3-dicarboxylate (PubChem CID 27058155) has the molecular formula C28H31NO6 and a molecular weight of 477.56 g/mol. Its IUPAC name is diethyl (1S,2R,3R,4S)-2-(1-benzylindol-3-yl)-4-hydroxy-4-methyl-6-oxocyclohexane-1,3-dicarboxylate.
| Compound Name | diethyl (1S,2R,3R,4S)-2-(1-benzylindol-3-yl)-4-hydroxy-4-methyl-6-oxocyclohexane-1,3-dicarboxylate |
|---|---|
| PubChem CID | 27058155 |
| Molecular Formula | C28H31NO6 |
| Molecular Weight | 477.56 g/mol |
| Exact Mass | 477.22 |
| IUPAC Name | diethyl (1S,2R,3R,4S)-2-(1-benzylindol-3-yl)-4-hydroxy-4-methyl-6-oxocyclohexane-1,3-dicarboxylate |
| SMILES | CCOC(=O)[C@@H]1C(=O)C[C@](C)(O)[C@H](C(=O)OCC)[C@H]1c1cn(Cc2ccccc2)c2ccccc12 |
| InChI | InChI=1S/C28H31NO6/c1-4-34-26(31)24-22(30)15-28(3,33)25(27(32)35-5-2)23(24)20-17-29(16-18-11-7-6-8-12-18)21-14-10-9-13-19(20)21/h6-14,17,23-25,33H,4-5,15-16H2,1-3H3/t23-,24+,25-,28-/m0/s1 |
| InChIKey | LTAHXIJYWLUUQV-GIBNYFNHSA-N |
| XLogP | 3.86 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.56 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|