C13H18N2O5 — CID 27065
acetamido(3-phenylpropyl)azanium;2-hydroxy-2-oxoacetate (PubChem CID 27065) has the molecular formula C13H18N2O5 and a molecular weight of 282.30 g/mol. Its IUPAC name is acetamido(3-phenylpropyl)azanium;2-hydroxy-2-oxoacetate.
| Compound Name | acetamido(3-phenylpropyl)azanium;2-hydroxy-2-oxoacetate |
|---|---|
| PubChem CID | 27065 |
| Molecular Formula | C13H18N2O5 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | acetamido(3-phenylpropyl)azanium;2-hydroxy-2-oxoacetate |
| SMILES | CC(=O)N[NH2+]CCCc1ccccc1.O=C([O-])C(=O)O |
| InChI | InChI=1S/C11H16N2O.C2H2O4/c1-10(14)13-12-9-5-8-11-6-3-2-4-7-11;3-1(4)2(5)6/h2-4,6-7,12H,5,8-9H2,1H3,(H,13,14);(H,3,4)(H,5,6) |
| InChIKey | AFDFLYDVRPFYLR-UHFFFAOYSA-N |
| XLogP | -1.95 |
| TPSA | 123.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | -1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|