C14H10ClN3O2S — CID 27065113
N-(4-chlorophenyl)-2-(4-oxothieno[3,2-d]pyrimidin-3-yl)acetamide (PubChem CID 27065113) has the molecular formula C14H10ClN3O2S and a molecular weight of 319.77 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-(4-oxothieno[3,2-d]pyrimidin-3-yl)acetamide.
| Compound Name | N-(4-chlorophenyl)-2-(4-oxothieno[3,2-d]pyrimidin-3-yl)acetamide |
|---|---|
| PubChem CID | 27065113 |
| Molecular Formula | C14H10ClN3O2S |
| Molecular Weight | 319.77 g/mol |
| Exact Mass | 319.02 |
| IUPAC Name | N-(4-chlorophenyl)-2-(4-oxothieno[3,2-d]pyrimidin-3-yl)acetamide |
| SMILES | O=C(Cn1cnc2ccsc2c1=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H10ClN3O2S/c15-9-1-3-10(4-2-9)17-12(19)7-18-8-16-11-5-6-21-13(11)14(18)20/h1-6,8H,7H2,(H,17,19) |
| InChIKey | FTRAJLSJCBRWRW-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.77 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |