C23H24FN3O4 — CID 27087934
(4R)-4-(3-ethoxy-4-prop-2-enoxyphenyl)-N-(4-fluorophenyl)-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxamide (PubChem CID 27087934) has the molecular formula C23H24FN3O4 and a molecular weight of 425.46 g/mol. Its IUPAC name is (4R)-4-(3-ethoxy-4-prop-2-enoxyphenyl)-N-(4-fluorophenyl)-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxamide.
| Compound Name | (4R)-4-(3-ethoxy-4-prop-2-enoxyphenyl)-N-(4-fluorophenyl)-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 27087934 |
| Molecular Formula | C23H24FN3O4 |
| Molecular Weight | 425.46 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | (4R)-4-(3-ethoxy-4-prop-2-enoxyphenyl)-N-(4-fluorophenyl)-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxamide |
| SMILES | C=CCOc1ccc([C@H]2NC(=O)NC(C)=C2C(=O)Nc2ccc(F)cc2)cc1OCC |
| InChI | InChI=1S/C23H24FN3O4/c1-4-12-31-18-11-6-15(13-19(18)30-5-2)21-20(14(3)25-23(29)27-21)22(28)26-17-9-7-16(24)8-10-17/h4,6-11,13,21H,1,5,12H2,2-3H3,(H,26,28)(H2,25,27,29)/t21-/m1/s1 |
| InChIKey | DLLPTZZWVNOYHK-OAQYLSRUSA-N |
| XLogP | 4.06 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.46 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|