C19H25BrN2O4S — CID 27088134
methyl (4S)-4-(2-bromo-4-butoxy-5-ethoxyphenyl)-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 27088134) has the molecular formula C19H25BrN2O4S and a molecular weight of 457.39 g/mol. Its IUPAC name is methyl (4S)-4-(2-bromo-4-butoxy-5-ethoxyphenyl)-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | methyl (4S)-4-(2-bromo-4-butoxy-5-ethoxyphenyl)-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 27088134 |
| Molecular Formula | C19H25BrN2O4S |
| Molecular Weight | 457.39 g/mol |
| Exact Mass | 456.07 |
| IUPAC Name | methyl (4S)-4-(2-bromo-4-butoxy-5-ethoxyphenyl)-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | CCCCOc1cc(Br)c([C@H]2NC(=S)NC(C)=C2C(=O)OC)cc1OCC |
| InChI | InChI=1S/C19H25BrN2O4S/c1-5-7-8-26-15-10-13(20)12(9-14(15)25-6-2)17-16(18(23)24-4)11(3)21-19(27)22-17/h9-10,17H,5-8H2,1-4H3,(H2,21,22,27)/t17-/m1/s1 |
| InChIKey | YNLFSMHGCWZWDR-QGZVFWFLSA-N |
| XLogP | 3.99 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.39 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|